CAS 91398-63-9 appears in our catalog under these names: 5-Chloro-3-methyl-benzofuran-2-carboxylic acid methyl ester, 95%, Methyl 5-chloro-3-methylbenzofuran-2-carboxylate, 97%, 5-Chloro-3-methyl-benzofuran-2-carboxylic acid methyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g, 0,5g.
Methyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate (CAS 91398-63-9) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: methyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate. InChIKey: LKQFSVREHNMXKY-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | methyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| InChIKey | LKQFSVREHNMXKY-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)