CAS 163684-50-2 appears in our catalog under these names: 4-(Chloromethyl)-7-hydroxy-8-methyl-2h-chromen-2-one, 95%, 4-(Chloromethyl)-7-hydroxy-8-methyl-2H-chromen-2-one 97%, 4-(chloromethyl)-7-hydroxy-8-methyl-2H-chromen-2-one, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-(chloromethyl)-7-hydroxy-8-methylchromen-2-one (CAS 163684-50-2) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 4-(chloromethyl)-7-hydroxy-8-methylchromen-2-one. InChIKey: JVVZWJIRFMWXCT-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-(chloromethyl)-7-hydroxy-8-methylchromen-2-one |
| InChIKey | JVVZWJIRFMWXCT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1OC(=O)C=C2CCl)O |
Computed by PubChem (NCBI)