CAS 1350652-35-5 is the registry number for 1-Phenyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg, 5g.
1-phenyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (CAS 1350652-35-5) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 1-phenyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole. InChIKey: PEMSJUWNDMCQEZ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 1-phenyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| InChIKey | PEMSJUWNDMCQEZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)N(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)