CAS 62306-08-5 is the registry number for 1-Ethyl-2-methyl-1,3-benzodiazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-ethyl-2-methylbenzimidazole-5-carbonitrile (CAS 62306-08-5) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 1-ethyl-2-methylbenzimidazole-5-carbonitrile. InChIKey: CRSLXELXHYBDGN-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 1-ethyl-2-methylbenzimidazole-5-carbonitrile |
| InChIKey | CRSLXELXHYBDGN-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=C1C=CC(=C2)C#N)C |
Computed by PubChem (NCBI)