CAS 41010-49-5 appears in our catalog under these names: 2-N-Phenylpyridine-2,3-diamine, 95%, N2-Phenylpyridine-2,3-diamine 95%, N2-Phenylpyridine-2,3-diamine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-N-phenylpyridine-2,3-diamine (CAS 41010-49-5) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-N-phenylpyridine-2,3-diamine. InChIKey: OLQLKEGDKARDNO-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-N-phenylpyridine-2,3-diamine |
| InChIKey | OLQLKEGDKARDNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=N2)N |
Computed by PubChem (NCBI)