CAS 99843-94-4 is the registry number for 2,6-Diamino-3-phenylpyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-phenylpyridine-2,6-diamine (CAS 99843-94-4) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 3-phenylpyridine-2,6-diamine. InChIKey: KIKSWQIAGIFEAY-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3-phenylpyridine-2,6-diamine |
| InChIKey | KIKSWQIAGIFEAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C=C2)N)N |
Computed by PubChem (NCBI)