CAS 25194-51-8 appears in our catalog under these names: 2-N-phenylpyridine-2,4-diamine, 97%, 2-N-phenylpyridine-2,4-diamine, 98%, 2–N–Phenylpyridine–2,4–diamine, N-2-Phenylpyridine-2,4-diamine, 2-N-Phenylpyridine-2,4-diamine, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg, 2,5g.
2-N-phenylpyridine-2,4-diamine (CAS 25194-51-8) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-N-phenylpyridine-2,4-diamine. InChIKey: PJMJABNEAAUEDW-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-N-phenylpyridine-2,4-diamine |
| InChIKey | PJMJABNEAAUEDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=CC(=C2)N |
Computed by PubChem (NCBI)