CAS 135070-65-4 appears in our catalog under these names: 4-Chloro-2-(4-methylphenyl)benzoic acid, 95%, 5-Chloro-4'-methyl-(1,1'-biphenyl)-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-chloro-2-(4-methylphenyl)benzoic acid (CAS 135070-65-4) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 4-chloro-2-(4-methylphenyl)benzoic acid. InChIKey: UVRIBLSFPZQTTJ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-chloro-2-(4-methylphenyl)benzoic acid |
| InChIKey | UVRIBLSFPZQTTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)