CAS 1350738-72-5 is the registry number for 2,4-dichloro-6-methyl-5H,6H,7H,8H-pyrido(4,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,4-dichloro-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (CAS 1350738-72-5) is a chemical compound with the molecular formula C8H9Cl2N3 and a molecular weight of 218.08 g/mol. IUPAC name: 2,4-dichloro-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine. InChIKey: UUNXJLUESRFPLL-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3 |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| InChIKey | UUNXJLUESRFPLL-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)