CAS 2167232-92-8 is the registry number for 4,6-Dichloro-2-(pyrrolidin-2-yl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-pyrrolidin-2-ylpyrimidine (CAS 2167232-92-8) is a chemical compound with the molecular formula C8H9Cl2N3 and a molecular weight of 218.08 g/mol. IUPAC name: 4,6-dichloro-2-pyrrolidin-2-ylpyrimidine. InChIKey: SDNQHXNGNJJUFA-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3 |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 4,6-dichloro-2-pyrrolidin-2-ylpyrimidine |
| InChIKey | SDNQHXNGNJJUFA-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)