CAS 2059993-86-9 appears in our catalog under these names: 1,7-Naphthyridin-6-amine dihydrochloride, 95%, 1,7-Naphthyridin-6-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,7-naphthyridin-6-amine;dihydrochloride (CAS 2059993-86-9) is a chemical compound with the molecular formula C8H9Cl2N3 and a molecular weight of 218.08 g/mol. IUPAC name: 1,7-naphthyridin-6-amine;dihydrochloride. InChIKey: VPSZDYYNHWTZGL-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3 |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 1,7-naphthyridin-6-amine;dihydrochloride |
| InChIKey | VPSZDYYNHWTZGL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC=C2N=C1)N.Cl.Cl |
Computed by PubChem (NCBI)