CAS 1801257-24-8 appears in our catalog under these names: BI SF3 (hydrochloride), BI SF3 (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 25 mg, 1 mg, 10 mg, 5 mg.
(5-chloro-2H-indazol-3-yl)methanamine;hydrochloride (CAS 1801257-24-8) is a chemical compound with the molecular formula C8H9Cl2N3 and a molecular weight of 218.08 g/mol. IUPAC name: (5-chloro-2H-indazol-3-yl)methanamine;hydrochloride. InChIKey: MPOSGKLUNWIIRB-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3 |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | (5-chloro-2H-indazol-3-yl)methanamine;hydrochloride |
| InChIKey | MPOSGKLUNWIIRB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1Cl)CN.Cl |
Computed by PubChem (NCBI)