CAS 1795497-44-7 is the registry number for 3-(1H-Imidazol-1-yl)pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-imidazol-1-ylpyridine;dihydrochloride (CAS 1795497-44-7) is a chemical compound with the molecular formula C8H9Cl2N3 and a molecular weight of 218.08 g/mol. IUPAC name: 3-imidazol-1-ylpyridine;dihydrochloride. InChIKey: MNQVPKXFVPLOPQ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3 |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 3-imidazol-1-ylpyridine;dihydrochloride |
| InChIKey | MNQVPKXFVPLOPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)N2C=CN=C2.Cl.Cl |
Computed by PubChem (NCBI)