CAS 1350925-20-0 is the registry number for 6-Chloro-1,2-dihydropyrido(2,3-b)pyrazin-3(4H)-one, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 5g, 1g.
6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one (CAS 1350925-20-0) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one. InChIKey: KMJARQBZUOZMQM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one |
| InChIKey | KMJARQBZUOZMQM-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)