CAS 135110-68-8 appears in our catalog under these names: 6-Hydroxyspiro[chromene-2,1'-cyclohexan]-4(3h)-one, 95%, 6-Hydroxyspiro(chroman-2,1'-cyclohexan)-4-one, 97%, 6–hydroxyspiro(chromene–2,1'–cyclohexan)–4(3H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g.
6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one (CAS 135110-68-8) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one. InChIKey: MWAGQRLEBNHEKW-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 6-hydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| InChIKey | MWAGQRLEBNHEKW-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)O |
Computed by PubChem (NCBI)