Products 1351238-30-6
CAS 1351238-30-6 is the registry number for Ethyl 7-bromothieno[2,3-b]pyrazine-6-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 7-bromothieno[2,3-b]pyrazine-6-carboxylate (CAS 1351238-30-6) is a chemical compound with the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. IUPAC name: ethyl 7-bromothieno[2,3-b]pyrazine-6-carboxylate. InChIKey: XJCRKLCOYAFBQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2S |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | ethyl 7-bromothieno[2,3-b]pyrazine-6-carboxylate |
| InChIKey | XJCRKLCOYAFBQW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=NC=CN=C2S1)Br |
Computed by PubChem (NCBI)