Products 1351478-05-1
CAS 1351478-05-1 is the registry number for 1-{5-Bromo-1H-pyrrolo(2,3-b)pyridin-3-yl}-2-chloroethan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-chloroethanone (CAS 1351478-05-1) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-chloroethanone. InChIKey: MNXYXGITZQLUFG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-chloroethanone |
| InChIKey | MNXYXGITZQLUFG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(=O)CCl)Br |
Computed by PubChem (NCBI)