CAS 1351580-15-8 appears in our catalog under these names: (R)–1–(2,3–Difluorophenyl)ethanamine hydrochloride, (R)-1-(2,3-Difluorophenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(2,3-DIFLUOROPHENYL)ETHANAMINE-HCL, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(1R)-1-(2,3-difluorophenyl)ethanamine;hydrochloride (CAS 1351580-15-8) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-1-(2,3-difluorophenyl)ethanamine;hydrochloride. InChIKey: BDCJXEVNICFRSL-NUBCRITNSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-1-(2,3-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BDCJXEVNICFRSL-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C(=CC=C1)F)F)N.Cl |
Computed by PubChem (NCBI)