CAS 1427378-79-7 appears in our catalog under these names: 1-(2,3-Difluorophenyl)ethan-1-amine hydrochloride, 95%, 1-(2,3-Difluorophenyl)ethan-1-amine hydrochloride, 1-(2,3-Difluorophenyl)ethanamine hydrochloride, 95%, 95%, 1-(2,3-Difluorophenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg, 100mg.
1-(2,3-difluorophenyl)ethanamine;hydrochloride (CAS 1427378-79-7) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 1-(2,3-difluorophenyl)ethanamine;hydrochloride. InChIKey: BDCJXEVNICFRSL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BDCJXEVNICFRSL-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC=C1)F)F)N.Cl |
Computed by PubChem (NCBI)