CAS 1352208-34-4 appears in our catalog under these names: Ethyl 3,4-difluoro-2-methylbenzoate, 95%, Ethyl 3,4-difluoro-2-methylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Ethyl 3,4-difluoro-2-methylbenzoate (CAS 1352208-34-4) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 3,4-difluoro-2-methylbenzoate. InChIKey: SOYVWKRBDKLWIE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 3,4-difluoro-2-methylbenzoate |
| InChIKey | SOYVWKRBDKLWIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)F)F)C |
Computed by PubChem (NCBI)