CAS 1352306-36-5 is the registry number for 2-Fluoro-3,6-dimethoxybenzoyl chloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-3,6-dimethoxybenzoyl chloride (CAS 1352306-36-5) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 2-fluoro-3,6-dimethoxybenzoyl chloride. InChIKey: MEVJHBRTVZESCT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 2-fluoro-3,6-dimethoxybenzoyl chloride |
| InChIKey | MEVJHBRTVZESCT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)F)C(=O)Cl |
Computed by PubChem (NCBI)