Products 1352745-78-8
CAS 1352745-78-8 is the registry number for 1,2-Di-tert-butyl 2-methyl-5-oxopyrrolidine-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ditert-butyl 2-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 1352745-78-8) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: ditert-butyl 2-methyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: ORKNGPXCDFIMEM-UHFFFAOYSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | ditert-butyl 2-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | ORKNGPXCDFIMEM-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)N1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)