CAS 1353560-54-9 is the registry number for Diaportheone A. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one (CAS 1353560-54-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one. InChIKey: MVZRYONJHYTQGJ-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one |
| InChIKey | MVZRYONJHYTQGJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C(=O)C3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)