Products 1353560-54-9

CAS 1353560-54-9 is the registry number for Diaportheone A. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.

Structural formula: {0} (CAS {1})

1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one (CAS 1353560-54-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one. InChIKey: MVZRYONJHYTQGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O4
Molecular weight218.20 g/mol
IUPAC name1,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one
InChIKeyMVZRYONJHYTQGJ-UHFFFAOYSA-N
SMILESC1CC2=C(C1O)C(=O)C3=C(C=CC=C3O2)O

Computed by PubChem (NCBI)