CAS 1353631-65-8 is the registry number for 2-(3-Azetidinyloxy)-pyridine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(azetidin-3-yloxy)pyridine;dihydrochloride (CAS 1353631-65-8) is a chemical compound with the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. IUPAC name: 2-(azetidin-3-yloxy)pyridine;dihydrochloride. InChIKey: JBXUNAKHBCYXIW-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 2-(azetidin-3-yloxy)pyridine;dihydrochloride |
| InChIKey | JBXUNAKHBCYXIW-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)