CAS 2248366-96-1 appears in our catalog under these names: 3,4-Dihydro-2H-pyrano(2,3-b)pyridin-4-amine dihydrochloride, 98%, 2H,3H,4H-Pyrano(2,3-b)pyridin-4-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-amine;dihydrochloride (CAS 2248366-96-1) is a chemical compound with the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. IUPAC name: 3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-amine;dihydrochloride. InChIKey: KQMRLMAHKAUAOG-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-amine;dihydrochloride |
| InChIKey | KQMRLMAHKAUAOG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)