CAS 956431-47-3 appears in our catalog under these names: 2,3,4,5-Tetrahydropyrido(3,2-f)(1,4)oxazepine dihydrochloride, 95+%, 2H,3H,4H,5H-Pyrido(3,2-F)(1,4)oxazepine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;dihydrochloride (CAS 956431-47-3) is a chemical compound with the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. IUPAC name: 2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;dihydrochloride. InChIKey: JZSSQVLDWJVGRT-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;dihydrochloride |
| InChIKey | JZSSQVLDWJVGRT-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)