CAS 1415564-55-4 appears in our catalog under these names: 3-(pyridin-2-yl)azetidin-3-ol.2HCl, 95%, 3-(Pyridin-2-yl)azetidin-3-ol dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 100mg.
3-pyridin-2-ylazetidin-3-ol;dihydrochloride (CAS 1415564-55-4) is a chemical compound with the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. IUPAC name: 3-pyridin-2-ylazetidin-3-ol;dihydrochloride. InChIKey: IXKQTUNNCHZFBW-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 3-pyridin-2-ylazetidin-3-ol;dihydrochloride |
| InChIKey | IXKQTUNNCHZFBW-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=CC=N2)O.Cl.Cl |
Computed by PubChem (NCBI)