CAS 2007917-04-4 appears in our catalog under these names: 3-(Pyridin-3-yl)oxetan-3-amine dihydrochloride, 95%, 3-(Pyridin-3-yl)oxetan-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
3-pyridin-3-yloxetan-3-amine;dihydrochloride (CAS 2007917-04-4) is a chemical compound with the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. IUPAC name: 3-pyridin-3-yloxetan-3-amine;dihydrochloride. InChIKey: KCGZZXQOIPLMAW-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 3-pyridin-3-yloxetan-3-amine;dihydrochloride |
| InChIKey | KCGZZXQOIPLMAW-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CN=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)