CAS 1353636-65-3 is the registry number for 1–(4–Chlorophenyl)–3–hydroxycyclobutanecarboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
1-(4-chlorophenyl)-3-hydroxycyclobutane-1-carboxylic acid (CAS 1353636-65-3) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-hydroxycyclobutane-1-carboxylic acid. InChIKey: PQVUQOBVSQOFKH-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-hydroxycyclobutane-1-carboxylic acid |
| InChIKey | PQVUQOBVSQOFKH-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC=C(C=C2)Cl)C(=O)O)O |
Computed by PubChem (NCBI)