Products 1353867-79-4
CAS 1353867-79-4 appears in our catalog under these names: Sulfanitran 13C6 (sulfanilamide ring 13C6), Sulfanitran-13C6, 13C6-Sulfanitran, Concentration: 100 µg/ml Solvent: Acetonitrile, 13C6-Sulfanitran. Offered by: Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 5mg, 1mg, 1x1ml, 1x10mg.
N-[4-[(4-nitrophenyl)sulfamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetamide (CAS 1353867-79-4) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 341.29 g/mol. IUPAC name: N-[4-[(4-nitrophenyl)sulfamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetamide. InChIKey: GWBPFRGXNGPPMF-BWWUJVEXSA-N.
| Molecular formula | C14H13N3O5S |
|---|---|
| Molecular weight | 341.29 g/mol |
| IUPAC name | N-[4-[(4-nitrophenyl)sulfamoyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetamide |
| InChIKey | GWBPFRGXNGPPMF-BWWUJVEXSA-N |
| SMILES | CC(=O)N[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)S(=O)(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)