CAS 1794753-46-0 appears in our catalog under these names: Sulfanitran-d4 (Major), Sulfanitran-d4, D4-Sulfanitran. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 2,5mg, 25mg, Get quote, 1x10mg.
N-[2,3,5,6-tetradeuterio-4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide (CAS 1794753-46-0) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 339.36 g/mol. IUPAC name: N-[2,3,5,6-tetradeuterio-4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide. InChIKey: GWBPFRGXNGPPMF-DOGSKSIHSA-N.
| Molecular formula | C14H13N3O5S |
|---|---|
| Molecular weight | 339.36 g/mol |
| IUPAC name | N-[2,3,5,6-tetradeuterio-4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide |
| InChIKey | GWBPFRGXNGPPMF-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])S(=O)(=O)NC2=CC=C(C=C2)[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)