CAS 412940-42-2 is the registry number for Z116334910, 99.32%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 25 mg, 5 mg.
4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide (CAS 412940-42-2) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. IUPAC name: 4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide. InChIKey: RYMKGJVSGVQNAG-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5S |
|---|---|
| Molecular weight | 335.34 g/mol |
| IUPAC name | 4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide |
| InChIKey | RYMKGJVSGVQNAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)