Products 412940-42-2

CAS 412940-42-2 is the registry number for Z116334910, 99.32%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide (CAS 412940-42-2) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. IUPAC name: 4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide. InChIKey: RYMKGJVSGVQNAG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O5S
Molecular weight335.34 g/mol
IUPAC name4-methyl-N-(3-nitrophenyl)-3-sulfamoylbenzamide
InChIKeyRYMKGJVSGVQNAG-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-])S(=O)(=O)N

Computed by PubChem (NCBI)