Products 832109-48-5
CAS 832109-48-5 is the registry number for DC-S238. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate (CAS 832109-48-5) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. IUPAC name: methyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate. InChIKey: BSKMIMMIUZSPKF-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5S |
|---|---|
| Molecular weight | 335.34 g/mol |
| IUPAC name | methyl 2-amino-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
| InChIKey | BSKMIMMIUZSPKF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)N)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)