CAS 864966-83-6 is the registry number for 2-Hydroxy-5-(2-(4-((methylamino)sulfonyl)phenyl)diazenyl)benzoic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-hydroxy-5-[[4-(methylsulfamoyl)phenyl]diazenyl]benzoic acid (CAS 864966-83-6) is a chemical compound with the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. IUPAC name: 2-hydroxy-5-[[4-(methylsulfamoyl)phenyl]diazenyl]benzoic acid. InChIKey: JNAMWZQUJCLHLA-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5S |
|---|---|
| Molecular weight | 335.34 g/mol |
| IUPAC name | 2-hydroxy-5-[[4-(methylsulfamoyl)phenyl]diazenyl]benzoic acid |
| InChIKey | JNAMWZQUJCLHLA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)N=NC2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)