CAS 13541-13-4 appears in our catalog under these names: 1-(3-Aminophenyl)-3,3,3-trifluoropropan-1-one, 95%, 1-(3-Aminophenyl)-3,3,3-trifluoropropan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-aminophenyl)-3,3,3-trifluoropropan-1-one (CAS 13541-13-4) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 1-(3-aminophenyl)-3,3,3-trifluoropropan-1-one. InChIKey: MPHOVHPZGIAIOO-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 1-(3-aminophenyl)-3,3,3-trifluoropropan-1-one |
| InChIKey | MPHOVHPZGIAIOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)CC(F)(F)F |
Computed by PubChem (NCBI)