CAS 135484-76-3 appears in our catalog under these names: Methyl 2-bromo-6-nitrobenzoate 98%, Methyl 2-bromo-6-nitrobenzoate, 98%, 98%, Methyl 2-bromo-6-nitrobenzoate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
Methyl 2-bromo-6-nitrobenzoate (CAS 135484-76-3) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-6-nitrobenzoate. InChIKey: CBQNPPDKHCOWGD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-6-nitrobenzoate |
| InChIKey | CBQNPPDKHCOWGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)