CAS 1354949-79-3 is the registry number for 2-Amino-3,5-difluoro-4-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3,5-difluoro-4-methoxybenzoic acid (CAS 1354949-79-3) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-amino-3,5-difluoro-4-methoxybenzoic acid. InChIKey: QFLZYYRNYHZXDJ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-amino-3,5-difluoro-4-methoxybenzoic acid |
| InChIKey | QFLZYYRNYHZXDJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)N)C(=O)O)F |
Computed by PubChem (NCBI)