Products 1354949-79-3

CAS 1354949-79-3 is the registry number for 2-Amino-3,5-difluoro-4-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3,5-difluoro-4-methoxybenzoic acid (CAS 1354949-79-3) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-amino-3,5-difluoro-4-methoxybenzoic acid. InChIKey: QFLZYYRNYHZXDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7F2NO3
Molecular weight203.14 g/mol
IUPAC name2-amino-3,5-difluoro-4-methoxybenzoic acid
InChIKeyQFLZYYRNYHZXDJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1F)N)C(=O)O)F

Computed by PubChem (NCBI)