Products 1354953-52-8
CAS 1354953-52-8 is the registry number for 1-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CAS 1354953-52-8) is a chemical compound with the molecular formula C8H16ClN3O and a molecular weight of 205.68 g/mol. IUPAC name: 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride. InChIKey: HFVKQKKEACYYLQ-UHFFFAOYSA-N.
| Molecular formula | C8H16ClN3O |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| InChIKey | HFVKQKKEACYYLQ-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)