Products 1354962-26-7
CAS 1354962-26-7 appears in our catalog under these names: 4-(Chlorosulfonyl)-2-fluorobenzoic acid, 95%, 4-(chlorosulfonyl)-2-fluorobenzoic acid, 4-(Chlorosulfonyl)-2-fluorobenzoic acid 95%, 4-(Chlorosulfonyl)-2-fluorobenzoic acid, 95%, 95%, 4-(chlorosulfonyl)-2-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg, 100mg, 250mg, 500mg.
4-chlorosulfonyl-2-fluorobenzoic acid (CAS 1354962-26-7) is a chemical compound with the molecular formula C7H4ClFO4S and a molecular weight of 238.62 g/mol. IUPAC name: 4-chlorosulfonyl-2-fluorobenzoic acid. InChIKey: LBEVLPITHCKEMK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO4S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chlorosulfonyl-2-fluorobenzoic acid |
| InChIKey | LBEVLPITHCKEMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)F)C(=O)O |
Computed by PubChem (NCBI)