Products 1934852-61-5

CAS 1934852-61-5 appears in our catalog under these names: 2-Chloro-4-(fluorosulfonyl)benzoic acid 95%, 2-Chloro-4-(fluorosulfonyl)benzoic acid, 95%, 95%, 2-CHLORO-4-(FLUOROSULFONYL)BENZOIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-fluorosulfonylbenzoic acid (CAS 1934852-61-5) is a chemical compound with the molecular formula C7H4ClFO4S and a molecular weight of 238.62 g/mol. IUPAC name: 2-chloro-4-fluorosulfonylbenzoic acid. InChIKey: BEXNYFYCTVODCD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFO4S
Molecular weight238.62 g/mol
IUPAC name2-chloro-4-fluorosulfonylbenzoic acid
InChIKeyBEXNYFYCTVODCD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)F)Cl)C(=O)O

Computed by PubChem (NCBI)