Products 244606-33-5
CAS 244606-33-5 appears in our catalog under these names: 4-(Chlorosulfonyl)-3-fluorobenzoic acid, 95%, 4-(chlorosulfonyl)-3-fluorobenzoic acid, 4-(Chlorosulfonyl)-3-fluorobenzoic acid, 97%, 97%, 4-(chlorosulfonyl)-3-fluorobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 500mg.
4-chlorosulfonyl-3-fluorobenzoic acid (CAS 244606-33-5) is a chemical compound with the molecular formula C7H4ClFO4S and a molecular weight of 238.62 g/mol. IUPAC name: 4-chlorosulfonyl-3-fluorobenzoic acid. InChIKey: BFEPIUXQMZTCQM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO4S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chlorosulfonyl-3-fluorobenzoic acid |
| InChIKey | BFEPIUXQMZTCQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)