CAS 21346-66-7 appears in our catalog under these names: 2-Chloro-5-(fluorosulfonyl)benzoic acid, 95%, 2-Chloro-5-(fluorosulfonyl)benzoic acid 97%, 2-Chloro-5-(fluorosulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-5-fluorosulfonylbenzoic acid (CAS 21346-66-7) is a chemical compound with the molecular formula C7H4ClFO4S and a molecular weight of 238.62 g/mol. IUPAC name: 2-chloro-5-fluorosulfonylbenzoic acid. InChIKey: HXVUCIYXBTYQLK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO4S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 2-chloro-5-fluorosulfonylbenzoic acid |
| InChIKey | HXVUCIYXBTYQLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)C(=O)O)Cl |
Computed by PubChem (NCBI)