CAS 912577-43-6 appears in our catalog under these names: 3-(Chlorosulfonyl)-5-fluorobenzoic acid, 95%, 3-(chlorosulfonyl)-5-fluorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g.
3-chlorosulfonyl-5-fluorobenzoic acid (CAS 912577-43-6) is a chemical compound with the molecular formula C7H4ClFO4S and a molecular weight of 238.62 g/mol. IUPAC name: 3-chlorosulfonyl-5-fluorobenzoic acid. InChIKey: QMIVFRSZWFNOFF-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO4S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 3-chlorosulfonyl-5-fluorobenzoic acid |
| InChIKey | QMIVFRSZWFNOFF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)