CAS 135531-92-9 appears in our catalog under these names: 5-Methoxy-4-nitro-1h-indole, 95%, 5–Methoxy–4–nitro–1H–indole, 5-Methoxy-4-nitro-1H-indole. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
5-methoxy-4-nitro-1H-indole (CAS 135531-92-9) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-methoxy-4-nitro-1H-indole. InChIKey: NPFMBMRULROMHX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-methoxy-4-nitro-1H-indole |
| InChIKey | NPFMBMRULROMHX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)