Products 135545-86-7
CAS 135545-86-7 is the registry number for 6,7-Dimethoxy-9,10-dihydrophenanthrene-2,5-diol, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 20mg.
6,7-dimethoxy-9,10-dihydrophenanthrene-2,5-diol (CAS 135545-86-7) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 6,7-dimethoxy-9,10-dihydrophenanthrene-2,5-diol. InChIKey: AUIUZJOPXKYLOS-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 6,7-dimethoxy-9,10-dihydrophenanthrene-2,5-diol |
| InChIKey | AUIUZJOPXKYLOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)CCC3=C2C=CC(=C3)O)O)OC |
Computed by PubChem (NCBI)