Products 1355534-07-4
CAS 1355534-07-4 is the registry number for 4-Nitro-1-[4-(trifluoromethyl)phenyl]-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-nitro-1-[4-(trifluoromethyl)phenyl]pyrazole (CAS 1355534-07-4) is a chemical compound with the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. IUPAC name: 4-nitro-1-[4-(trifluoromethyl)phenyl]pyrazole. InChIKey: RNHVPQPSVNYEGW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N3O2 |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 4-nitro-1-[4-(trifluoromethyl)phenyl]pyrazole |
| InChIKey | RNHVPQPSVNYEGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)