Products 1356011-67-0
CAS 1356011-67-0 appears in our catalog under these names: Nateglinide EP Impurity E-d5 , 4-Desisopropyl-4-ethyl Nateglinide-d5. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-[(4-ethylcyclohexanecarbonyl)amino]-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 1356011-67-0) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 308.4 g/mol. IUPAC name: (2R)-2-[(4-ethylcyclohexanecarbonyl)amino]-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: LLSFDDAYCLFQJP-PLLWDJBJSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (2R)-2-[(4-ethylcyclohexanecarbonyl)amino]-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | LLSFDDAYCLFQJP-PLLWDJBJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@H](C(=O)O)NC(=O)C2CCC(CC2)CC)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
4-Desisopropyl-4-ethyl Nateglinide-d5