Products 1356395-13-5
CAS 1356395-13-5 is the registry number for Ramelteon Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetate (CAS 1356395-13-5) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: methyl 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetate. InChIKey: VYYNJUOOCHSSIQ-JTQLQIEISA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | methyl 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetate |
| InChIKey | VYYNJUOOCHSSIQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)
Synonyms:
Ramelteon impurity 9, methyl 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetate, 2H-Indeno(5,4-b)furan-8-acetic acid, 1,6,7,8-tetrahydro-, methyl ester, (8S)-, Ramelteon Impurity 34, Ramelteon Impurity 68, methyl (S)-2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)acetate