CAS 30292-75-2 is the registry number for Ethyl 2-(3-Chlorobenzyl)-3-oxobutanoate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 2-[(3-chlorophenyl)methyl]-3-oxobutanoate (CAS 30292-75-2) is a chemical compound with the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. IUPAC name: ethyl 2-[(3-chlorophenyl)methyl]-3-oxobutanoate. InChIKey: AKCGBPLXOXNIRT-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | ethyl 2-[(3-chlorophenyl)methyl]-3-oxobutanoate |
| InChIKey | AKCGBPLXOXNIRT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC(=CC=C1)Cl)C(=O)C |
Computed by PubChem (NCBI)