CAS 13565-08-7 appears in our catalog under these names: 4–Fluorocinnamoyl chloride, (E)-3-(4-Fluorophenyl)acryloyl chloride 95%, (E)-3-(4-Fluoro-phenyl)-acryloyl chloride, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(E)-3-(4-fluorophenyl)prop-2-enoyl chloride (CAS 13565-08-7) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: (E)-3-(4-fluorophenyl)prop-2-enoyl chloride. InChIKey: GLBIKPKWQDIQCJ-ZZXKWVIFSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | (E)-3-(4-fluorophenyl)prop-2-enoyl chloride |
| InChIKey | GLBIKPKWQDIQCJ-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)Cl)F |
Computed by PubChem (NCBI)